C22H24Cl2N6O3 — CID 6310521
(1E,3E)-1-(benzotriazol-1-yl)-3,4-dichloro-N-(4-ethoxyphenyl)-N',N'-diethyl-2-nitrobuta-1,3-diene-1,4-diamine (PubChem CID 6310521) has the molecular formula C22H24Cl2N6O3 and a molecular weight of 491.38 g/mol. Its IUPAC name is (1E,3E)-1-(benzotriazol-1-yl)-3,4-dichloro-N-(4-ethoxyphenyl)-N',N'-diethyl-2-nitrobuta-1,3-diene-1,4-diamine.
| Compound Name | (1E,3E)-1-(benzotriazol-1-yl)-3,4-dichloro-N-(4-ethoxyphenyl)-N',N'-diethyl-2-nitrobuta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 6310521 |
| Molecular Formula | C22H24Cl2N6O3 |
| Molecular Weight | 491.38 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | (1E,3E)-1-(benzotriazol-1-yl)-3,4-dichloro-N-(4-ethoxyphenyl)-N',N'-diethyl-2-nitrobuta-1,3-diene-1,4-diamine |
| SMILES | CCOc1ccc(N/C(=C(C(/Cl)=C(\Cl)N(CC)CC)\[N+](=O)[O-])n2nnc3ccccc32)cc1 |
| InChI | InChI=1S/C22H24Cl2N6O3/c1-4-28(5-2)21(24)19(23)20(30(31)32)22(25-15-11-13-16(14-12-15)33-6-3)29-18-10-8-7-9-17(18)26-27-29/h7-14,25H,4-6H2,1-3H3/b21-19-,22-20+ |
| InChIKey | QNHIQUNACJPXIS-OLAQIDGISA-N |
| XLogP | 5.33 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.38 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|