C15H23NO4 — CID 15420990
diethyl (E,4Z)-4-(azepan-2-ylidene)pent-2-enedioate (PubChem CID 15420990) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is diethyl (E,4Z)-4-(azepan-2-ylidene)pent-2-enedioate.
| Compound Name | diethyl (E,4Z)-4-(azepan-2-ylidene)pent-2-enedioate |
|---|---|
| PubChem CID | 15420990 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | diethyl (E,4Z)-4-(azepan-2-ylidene)pent-2-enedioate |
| SMILES | CCOC(=O)/C=C/C(C(=O)OCC)=C1\CCCCCN1 |
| InChI | InChI=1S/C15H23NO4/c1-3-19-14(17)10-9-12(15(18)20-4-2)13-8-6-5-7-11-16-13/h9-10,16H,3-8,11H2,1-2H3/b10-9+,13-12- |
| InChIKey | PHMXSBJFEOOXKK-FWIFIWDMSA-N |
| XLogP | 2.09 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|