C13H20N2O4 — CID 23247523
diethyl (E,4E)-4-(1-methylimidazolidin-2-ylidene)pent-2-enedioate (PubChem CID 23247523) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is diethyl (E,4E)-4-(1-methylimidazolidin-2-ylidene)pent-2-enedioate.
| Compound Name | diethyl (E,4E)-4-(1-methylimidazolidin-2-ylidene)pent-2-enedioate |
|---|---|
| PubChem CID | 23247523 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | diethyl (E,4E)-4-(1-methylimidazolidin-2-ylidene)pent-2-enedioate |
| SMILES | CCOC(=O)/C=C/C(C(=O)OCC)=C1/NCCN1C |
| InChI | InChI=1S/C13H20N2O4/c1-4-18-11(16)7-6-10(13(17)19-5-2)12-14-8-9-15(12)3/h6-7,14H,4-5,8-9H2,1-3H3/b7-6+,12-10+ |
| InChIKey | JKRRHGIFSSPRDY-AOQSKOSGSA-N |
| XLogP | 0.42 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|