C17H32N2O6S2 — CID 154217167
4,5-bis[[2-(2-ethoxyethylsulfanyl)acetyl]amino]pentanoic acid (PubChem CID 154217167) has the molecular formula C17H32N2O6S2 and a molecular weight of 424.59 g/mol. Its IUPAC name is 4,5-bis[[2-(2-ethoxyethylsulfanyl)acetyl]amino]pentanoic acid.
| Compound Name | 4,5-bis[[2-(2-ethoxyethylsulfanyl)acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 154217167 |
| Molecular Formula | C17H32N2O6S2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 4,5-bis[[2-(2-ethoxyethylsulfanyl)acetyl]amino]pentanoic acid |
| SMILES | CCOCCSCC(=O)NCC(CCC(=O)O)NC(=O)CSCCOCC |
| InChI | InChI=1S/C17H32N2O6S2/c1-3-24-7-9-26-12-15(20)18-11-14(5-6-17(22)23)19-16(21)13-27-10-8-25-4-2/h14H,3-13H2,1-2H3,(H,18,20)(H,19,21)(H,22,23) |
| InChIKey | RBXDXRPUBSUBJS-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|