C23H43N3O11S2 — CID 18651209
(2S,6S)-2-[(1S,2R,3R)-4-amino-1,2,3-trihydroxybutyl]-6,7-bis[[2-(2-ethoxyethylsulfanyl)acetyl]amino]-2-hydroxy-3-oxoheptanoic acid (PubChem CID 18651209) has the molecular formula C23H43N3O11S2 and a molecular weight of 601.74 g/mol. Its IUPAC name is (2S,6S)-2-[(1S,2R,3R)-4-amino-1,2,3-trihydroxybutyl]-6,7-bis[[2-(2-ethoxyethylsulfanyl)acetyl]amino]-2-hydroxy-3-oxoheptanoic acid.
| Compound Name | (2S,6S)-2-[(1S,2R,3R)-4-amino-1,2,3-trihydroxybutyl]-6,7-bis[[2-(2-ethoxyethylsulfanyl)acetyl]amino]-2-hydroxy-3-oxoheptanoic acid |
|---|---|
| PubChem CID | 18651209 |
| Molecular Formula | C23H43N3O11S2 |
| Molecular Weight | 601.74 g/mol |
| Exact Mass | 601.23 |
| IUPAC Name | (2S,6S)-2-[(1S,2R,3R)-4-amino-1,2,3-trihydroxybutyl]-6,7-bis[[2-(2-ethoxyethylsulfanyl)acetyl]amino]-2-hydroxy-3-oxoheptanoic acid |
| SMILES | CCOCCSCC(=O)NC[C@H](CCC(=O)[C@](O)(C(=O)O)[C@@H](O)[C@H](O)[C@H](O)CN)NC(=O)CSCCOCC |
| InChI | InChI=1S/C23H43N3O11S2/c1-3-36-7-9-38-13-18(29)25-12-15(26-19(30)14-39-10-8-37-4-2)5-6-17(28)23(35,22(33)34)21(32)20(31)16(27)11-24/h15-16,20-21,27,31-32,35H,3-14,24H2,1-2H3,(H,25,29)(H,26,30)(H,33,34)/t15-,16+,20+,21-,23+/m0/s1 |
| InChIKey | QEMTVNKPMCYVQR-BRWZEMDJSA-N |
| XLogP | -2.67 |
| TPSA | 237.97 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.74 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|