C12H29Cl2N3OS — CID 119997452
N-(3-amino-2-methylpropyl)-2-[2-(diethylamino)ethylsulfanyl]acetamide;dihydrochloride (PubChem CID 119997452) has the molecular formula C12H29Cl2N3OS and a molecular weight of 334.36 g/mol. Its IUPAC name is N-(3-amino-2-methylpropyl)-2-[2-(diethylamino)ethylsulfanyl]acetamide;dihydrochloride.
| Compound Name | N-(3-amino-2-methylpropyl)-2-[2-(diethylamino)ethylsulfanyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119997452 |
| Molecular Formula | C12H29Cl2N3OS |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | N-(3-amino-2-methylpropyl)-2-[2-(diethylamino)ethylsulfanyl]acetamide;dihydrochloride |
| SMILES | CCN(CC)CCSCC(=O)NCC(C)CN.Cl.Cl |
| InChI | InChI=1S/C12H27N3OS.2ClH/c1-4-15(5-2)6-7-17-10-12(16)14-9-11(3)8-13;;/h11H,4-10,13H2,1-3H3,(H,14,16);2*1H |
| InChIKey | XITBAOCZNPLJMC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|