C15H26N6 — CID 154228565
4-(cyclopropylmethyl)-6-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-1H-pyrimidine-2,4-diamine (PubChem CID 154228565) has the molecular formula C15H26N6 and a molecular weight of 290.41 g/mol. Its IUPAC name is 4-(cyclopropylmethyl)-6-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-1H-pyrimidine-2,4-diamine.
| Compound Name | 4-(cyclopropylmethyl)-6-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-1H-pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 154228565 |
| Molecular Formula | C15H26N6 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 4-(cyclopropylmethyl)-6-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-1H-pyrimidine-2,4-diamine |
| SMILES | CN1CC2CN(C3=CC(N)(CC4CC4)N=C(N)N3)CC2C1 |
| InChI | InChI=1S/C15H26N6/c1-20-6-11-8-21(9-12(11)7-20)13-5-15(17,4-10-2-3-10)19-14(16)18-13/h5,10-12H,2-4,6-9,17H2,1H3,(H3,16,18,19) |
| InChIKey | FUNTYTUYHURNAW-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 82.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |