C16H9NO3S — CID 15422866
3-(1-benzothiophen-3-yl)-4-(furan-2-yl)pyrrole-2,5-dione (PubChem CID 15422866) has the molecular formula C16H9NO3S and a molecular weight of 295.32 g/mol. Its IUPAC name is 3-(1-benzothiophen-3-yl)-4-(furan-2-yl)pyrrole-2,5-dione.
| Compound Name | 3-(1-benzothiophen-3-yl)-4-(furan-2-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 15422866 |
| Molecular Formula | C16H9NO3S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 3-(1-benzothiophen-3-yl)-4-(furan-2-yl)pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2csc3ccccc23)=C1c1ccco1 |
| InChI | InChI=1S/C16H9NO3S/c18-15-13(10-8-21-12-6-2-1-4-9(10)12)14(16(19)17-15)11-5-3-7-20-11/h1-8H,(H,17,18,19) |
| InChIKey | NWMXBPYYVHLUGG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|