C24H22N2O2S — CID 177060181
3-(1-benzothiophen-3-yl)-4-(6,7,8,9-tetrahydro-1H-benzo[g]indol-3-yl)pyrrole-2,5-dione;molecular hydrogen (PubChem CID 177060181) has the molecular formula C24H22N2O2S and a molecular weight of 402.52 g/mol. Its IUPAC name is 3-(1-benzothiophen-3-yl)-4-(6,7,8,9-tetrahydro-1H-benzo[g]indol-3-yl)pyrrole-2,5-dione;molecular hydrogen.
| Compound Name | 3-(1-benzothiophen-3-yl)-4-(6,7,8,9-tetrahydro-1H-benzo[g]indol-3-yl)pyrrole-2,5-dione;molecular hydrogen |
|---|---|
| PubChem CID | 177060181 |
| Molecular Formula | C24H22N2O2S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 3-(1-benzothiophen-3-yl)-4-(6,7,8,9-tetrahydro-1H-benzo[g]indol-3-yl)pyrrole-2,5-dione;molecular hydrogen |
| SMILES | O=C1NC(=O)C(c2c[nH]c3c4c(ccc23)CCCC4)=C1c1csc2ccccc12.[H][H].[H][H] |
| InChI | InChI=1S/C24H18N2O2S.2H2/c27-23-20(17-11-25-22-14-6-2-1-5-13(14)9-10-16(17)22)21(24(28)26-23)18-12-29-19-8-4-3-7-15(18)19;;/h3-4,7-12,25H,1-2,5-6H2,(H,26,27,28);2*1H |
| InChIKey | JUQDPGPREHHFEB-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|