C15H13F3N3O2- — CID 154228960
(E)-3-[3-propan-2-yl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazol-4-yl]prop-2-enoate (PubChem CID 154228960) has the molecular formula C15H13F3N3O2- and a molecular weight of 324.28 g/mol. Its IUPAC name is (E)-3-[3-propan-2-yl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazol-4-yl]prop-2-enoate.
| Compound Name | (E)-3-[3-propan-2-yl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 154228960 |
| Molecular Formula | C15H13F3N3O2- |
| Molecular Weight | 324.28 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | (E)-3-[3-propan-2-yl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazol-4-yl]prop-2-enoate |
| SMILES | CC(C)c1nn(-c2ccc(C(F)(F)F)cn2)cc1/C=C/C(=O)[O-] |
| InChI | InChI=1S/C15H14F3N3O2/c1-9(2)14-10(3-6-13(22)23)8-21(20-14)12-5-4-11(7-19-12)15(16,17)18/h3-9H,1-2H3,(H,22,23)/p-1/b6-3+ |
| InChIKey | HUAOGZPWENHRME-ZZXKWVIFSA-M |
| XLogP | 2.17 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|