C23H24F3N3O4 — CID 90978269
[3-methoxy-4-[2-[3-propan-2-yl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazol-4-yl]ethoxy]phenyl] acetate (PubChem CID 90978269) has the molecular formula C23H24F3N3O4 and a molecular weight of 463.46 g/mol. Its IUPAC name is [3-methoxy-4-[2-[3-propan-2-yl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazol-4-yl]ethoxy]phenyl] acetate.
| Compound Name | [3-methoxy-4-[2-[3-propan-2-yl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazol-4-yl]ethoxy]phenyl] acetate |
|---|---|
| PubChem CID | 90978269 |
| Molecular Formula | C23H24F3N3O4 |
| Molecular Weight | 463.46 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | [3-methoxy-4-[2-[3-propan-2-yl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazol-4-yl]ethoxy]phenyl] acetate |
| SMILES | COc1cc(OC(C)=O)ccc1OCCc1cn(-c2ccc(C(F)(F)F)cn2)nc1C(C)C |
| InChI | InChI=1S/C23H24F3N3O4/c1-14(2)22-16(13-29(28-22)21-8-5-17(12-27-21)23(24,25)26)9-10-32-19-7-6-18(33-15(3)30)11-20(19)31-4/h5-8,11-14H,9-10H2,1-4H3 |
| InChIKey | LIBULBCEZKTNCD-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.46 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|