C23H23F4N3O3 — CID 91565801
[2-fluoro-3-[3-[3-propyl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazol-4-yl]propoxy]phenyl] acetate (PubChem CID 91565801) has the molecular formula C23H23F4N3O3 and a molecular weight of 465.45 g/mol. Its IUPAC name is [2-fluoro-3-[3-[3-propyl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazol-4-yl]propoxy]phenyl] acetate.
| Compound Name | [2-fluoro-3-[3-[3-propyl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazol-4-yl]propoxy]phenyl] acetate |
|---|---|
| PubChem CID | 91565801 |
| Molecular Formula | C23H23F4N3O3 |
| Molecular Weight | 465.45 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | [2-fluoro-3-[3-[3-propyl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazol-4-yl]propoxy]phenyl] acetate |
| SMILES | CCCc1nn(-c2ccc(C(F)(F)F)cn2)cc1CCCOc1cccc(OC(C)=O)c1F |
| InChI | InChI=1S/C23H23F4N3O3/c1-3-6-18-16(14-30(29-18)21-11-10-17(13-28-21)23(25,26)27)7-5-12-32-19-8-4-9-20(22(19)24)33-15(2)31/h4,8-11,13-14H,3,5-7,12H2,1-2H3 |
| InChIKey | GKRUTQNRTWXUBP-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.45 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|