C24H26F3N3O4 — CID 91316923
[3-methoxy-5-[3-[3-propan-2-yl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazol-4-yl]propoxy]phenyl] acetate (PubChem CID 91316923) has the molecular formula C24H26F3N3O4 and a molecular weight of 477.48 g/mol. Its IUPAC name is [3-methoxy-5-[3-[3-propan-2-yl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazol-4-yl]propoxy]phenyl] acetate.
| Compound Name | [3-methoxy-5-[3-[3-propan-2-yl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazol-4-yl]propoxy]phenyl] acetate |
|---|---|
| PubChem CID | 91316923 |
| Molecular Formula | C24H26F3N3O4 |
| Molecular Weight | 477.48 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | [3-methoxy-5-[3-[3-propan-2-yl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazol-4-yl]propoxy]phenyl] acetate |
| SMILES | COc1cc(OCCCc2cn(-c3ccc(C(F)(F)F)cn3)nc2C(C)C)cc(OC(C)=O)c1 |
| InChI | InChI=1S/C24H26F3N3O4/c1-15(2)23-17(14-30(29-23)22-8-7-18(13-28-22)24(25,26)27)6-5-9-33-20-10-19(32-4)11-21(12-20)34-16(3)31/h7-8,10-15H,5-6,9H2,1-4H3 |
| InChIKey | GHJFWQAITODDKY-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.48 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|