C25H36O6 — CID 154232005
[(8R,9S,10R,13R,14S)-15,15-diacetyloxy-10,13-dimethyl-1,2,3,6,7,8,9,11,12,14,16,17-dodecahydrocyclopenta[a]phenanthren-16-yl] acetate (PubChem CID 154232005) has the molecular formula C25H36O6 and a molecular weight of 432.56 g/mol. Its IUPAC name is [(8R,9S,10R,13R,14S)-15,15-diacetyloxy-10,13-dimethyl-1,2,3,6,7,8,9,11,12,14,16,17-dodecahydrocyclopenta[a]phenanthren-16-yl] acetate.
| Compound Name | [(8R,9S,10R,13R,14S)-15,15-diacetyloxy-10,13-dimethyl-1,2,3,6,7,8,9,11,12,14,16,17-dodecahydrocyclopenta[a]phenanthren-16-yl] acetate |
|---|---|
| PubChem CID | 154232005 |
| Molecular Formula | C25H36O6 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | [(8R,9S,10R,13R,14S)-15,15-diacetyloxy-10,13-dimethyl-1,2,3,6,7,8,9,11,12,14,16,17-dodecahydrocyclopenta[a]phenanthren-16-yl] acetate |
| SMILES | CC(=O)OC1C[C@@]2(C)CC[C@H]3[C@@H](CCC4=CCCC[C@@]43C)[C@@H]2C1(OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C25H36O6/c1-15(26)29-21-14-23(4)13-11-20-19(10-9-18-8-6-7-12-24(18,20)5)22(23)25(21,30-16(2)27)31-17(3)28/h8,19-22H,6-7,9-14H2,1-5H3/t19-,20+,21?,22+,23-,24+/m1/s1 |
| InChIKey | OYYCJKGIXJCWJM-RYZNDSJNSA-N |
| XLogP | 4.70 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|