C21H17F9NO4- — CID 154233325
3,3-bis[3-(trifluoromethoxy)phenyl]-4-(3,3,3-trifluoropropylamino)butanoate (PubChem CID 154233325) has the molecular formula C21H17F9NO4- and a molecular weight of 518.35 g/mol. Its IUPAC name is 3,3-bis[3-(trifluoromethoxy)phenyl]-4-(3,3,3-trifluoropropylamino)butanoate.
| Compound Name | 3,3-bis[3-(trifluoromethoxy)phenyl]-4-(3,3,3-trifluoropropylamino)butanoate |
|---|---|
| PubChem CID | 154233325 |
| Molecular Formula | C21H17F9NO4- |
| Molecular Weight | 518.35 g/mol |
| Exact Mass | 518.10 |
| IUPAC Name | 3,3-bis[3-(trifluoromethoxy)phenyl]-4-(3,3,3-trifluoropropylamino)butanoate |
| SMILES | O=C([O-])CC(CNCCC(F)(F)F)(c1cccc(OC(F)(F)F)c1)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C21H18F9NO4/c22-19(23,24)7-8-31-12-18(11-17(32)33,13-3-1-5-15(9-13)34-20(25,26)27)14-4-2-6-16(10-14)35-21(28,29)30/h1-6,9-10,31H,7-8,11-12H2,(H,32,33)/p-1 |
| InChIKey | OPJGXKZKGYFGOM-UHFFFAOYSA-M |
| XLogP | 4.45 |
| TPSA | 70.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.35 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|