C25H26F9NO4 — CID 59192778
tert-butyl 3,3-bis[3-(trifluoromethoxy)phenyl]-4-(3,3,3-trifluoropropylamino)butanoate (PubChem CID 59192778) has the molecular formula C25H26F9NO4 and a molecular weight of 575.47 g/mol. Its IUPAC name is tert-butyl 3,3-bis[3-(trifluoromethoxy)phenyl]-4-(3,3,3-trifluoropropylamino)butanoate.
| Compound Name | tert-butyl 3,3-bis[3-(trifluoromethoxy)phenyl]-4-(3,3,3-trifluoropropylamino)butanoate |
|---|---|
| PubChem CID | 59192778 |
| Molecular Formula | C25H26F9NO4 |
| Molecular Weight | 575.47 g/mol |
| Exact Mass | 575.17 |
| IUPAC Name | tert-butyl 3,3-bis[3-(trifluoromethoxy)phenyl]-4-(3,3,3-trifluoropropylamino)butanoate |
| SMILES | CC(C)(C)OC(=O)CC(CNCCC(F)(F)F)(c1cccc(OC(F)(F)F)c1)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C25H26F9NO4/c1-21(2,3)39-20(36)14-22(15-35-11-10-23(26,27)28,16-6-4-8-18(12-16)37-24(29,30)31)17-7-5-9-19(13-17)38-25(32,33)34/h4-9,12-13,35H,10-11,14-15H2,1-3H3 |
| InChIKey | TVKVIBRKRIEHAV-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.47 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|