C13H12N6O — CID 154234866
9-(2-pyridin-2-ylethyl)purine-2-carboxamide (PubChem CID 154234866) has the molecular formula C13H12N6O and a molecular weight of 268.28 g/mol. Its IUPAC name is 9-(2-pyridin-2-ylethyl)purine-2-carboxamide.
| Compound Name | 9-(2-pyridin-2-ylethyl)purine-2-carboxamide |
|---|---|
| PubChem CID | 154234866 |
| Molecular Formula | C13H12N6O |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 9-(2-pyridin-2-ylethyl)purine-2-carboxamide |
| SMILES | NC(=O)c1ncc2ncn(CCc3ccccn3)c2n1 |
| InChI | InChI=1S/C13H12N6O/c14-11(20)12-16-7-10-13(18-12)19(8-17-10)6-4-9-3-1-2-5-15-9/h1-3,5,7-8H,4,6H2,(H2,14,20) |
| InChIKey | MEQGBBKEEHSXCN-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 99.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |