C6H3F3O4 — CID 154237911
3,4,4-trifluorocyclobut-2-ene-1,2-dicarboxylic acid (PubChem CID 154237911) has the molecular formula C6H3F3O4 and a molecular weight of 196.08 g/mol. Its IUPAC name is 3,4,4-trifluorocyclobut-2-ene-1,2-dicarboxylic acid.
| Compound Name | 3,4,4-trifluorocyclobut-2-ene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 154237911 |
| Molecular Formula | C6H3F3O4 |
| Molecular Weight | 196.08 g/mol |
| Exact Mass | 196.00 |
| IUPAC Name | 3,4,4-trifluorocyclobut-2-ene-1,2-dicarboxylic acid |
| SMILES | O=C(O)C1=C(F)C(F)(F)C1C(=O)O |
| InChI | InChI=1S/C6H3F3O4/c7-3-1(4(10)11)2(5(12)13)6(3,8)9/h2H,(H,10,11)(H,12,13) |
| InChIKey | OBHAJCNAXZMJIP-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.08 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |