3,4,4-trifluorocyclobut-2-ene-1,2-dicarboxylic acid

C6H3F3O4 — CID 154237911

IUPAC3,4,4-trifluorocyclobut-2-ene-1,2-dicarboxylic acid
SMILESO=C(O)C1=C(F)C(F)(F)C1C(=O)O
InChIInChI=1S/C6H3F3O4/c7-3-1(4(10)11)2(5(12)13)6(3,8)9/h2H,(H,10,11)(H,12,13)
InChIKeyOBHAJCNAXZMJIP-UHFFFAOYSA-N
MW196.08 g/mol
LogP0.64
Rot. Bonds2

About 3,4,4-trifluorocyclobut-2-ene-1,2-dicarboxylic acid

3,4,4-trifluorocyclobut-2-ene-1,2-dicarboxylic acid (PubChem CID 154237911) has the molecular formula C6H3F3O4 and a molecular weight of 196.08 g/mol. Its IUPAC name is 3,4,4-trifluorocyclobut-2-ene-1,2-dicarboxylic acid.

Molecular Properties

Compound Name3,4,4-trifluorocyclobut-2-ene-1,2-dicarboxylic acid
PubChem CID154237911
Molecular FormulaC6H3F3O4
Molecular Weight196.08 g/mol
Exact Mass196.00
IUPAC Name3,4,4-trifluorocyclobut-2-ene-1,2-dicarboxylic acid
SMILESO=C(O)C1=C(F)C(F)(F)C1C(=O)O
InChIInChI=1S/C6H3F3O4/c7-3-1(4(10)11)2(5(12)13)6(3,8)9/h2H,(H,10,11)(H,12,13)
InChIKeyOBHAJCNAXZMJIP-UHFFFAOYSA-N
XLogP0.64
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.08
LogP ≤ 50.64
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3,4,4-trifluorocyclobut-2-ene-1,2-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,4,4-trifluorocyclobut-2-ene-1,2-dicarboxylic acid?
The IUPAC name of 3,4,4-trifluorocyclobut-2-ene-1,2-dicarboxylic acid (CID 154237911) is 3,4,4-trifluorocyclobut-2-ene-1,2-dicarboxylic acid.
What is the SMILES notation for 3,4,4-trifluorocyclobut-2-ene-1,2-dicarboxylic acid?
The canonical SMILES for 3,4,4-trifluorocyclobut-2-ene-1,2-dicarboxylic acid is O=C(O)C1=C(F)C(F)(F)C1C(=O)O.
What is the InChIKey of 3,4,4-trifluorocyclobut-2-ene-1,2-dicarboxylic acid?
The InChIKey is OBHAJCNAXZMJIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3F3O4/c7-3-1(4(10)11)2(5(12)13)6(3,8)9/h2H,(H,10,11)(H,12,13).
What are the key properties of 3,4,4-trifluorocyclobut-2-ene-1,2-dicarboxylic acid?
3,4,4-trifluorocyclobut-2-ene-1,2-dicarboxylic acid has a molecular weight of 196.08 g/mol, XLogP of 0.64, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,4-trifluorocyclobut-2-ene-1,2-dicarboxylic acid is sourced from PubChem (CID 154237911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).