C7H3Cl2F3O — CID 173294034
2-chloro-5,6,6-trifluorocyclohexa-2,4-diene-1-carbonyl chloride (PubChem CID 173294034) has the molecular formula C7H3Cl2F3O and a molecular weight of 231.00 g/mol. Its IUPAC name is 2-chloro-5,6,6-trifluorocyclohexa-2,4-diene-1-carbonyl chloride.
| Compound Name | 2-chloro-5,6,6-trifluorocyclohexa-2,4-diene-1-carbonyl chloride |
|---|---|
| PubChem CID | 173294034 |
| Molecular Formula | C7H3Cl2F3O |
| Molecular Weight | 231.00 g/mol |
| Exact Mass | 229.95 |
| IUPAC Name | 2-chloro-5,6,6-trifluorocyclohexa-2,4-diene-1-carbonyl chloride |
| SMILES | O=C(Cl)C1C(Cl)=CC=C(F)C1(F)F |
| InChI | InChI=1S/C7H3Cl2F3O/c8-3-1-2-4(10)7(11,12)5(3)6(9)13/h1-2,5H |
| InChIKey | AESDOLCQEUVAER-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.00 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|