4-amino-3-fluorocyclopent-2-ene-1-carboxylic acid

C6H8FNO2 — CID 73242045

IUPAC4-amino-3-fluorocyclopent-2-ene-1-carboxylic acid
SMILESNC1CC(C(=O)O)C=C1F
InChIInChI=1S/C6H8FNO2/c7-4-1-3(6(9)10)2-5(4)8/h1,3,5H,2,8H2,(H,9,10)
InChIKeyHYFGNSPBWCIGEO-UHFFFAOYSA-N
MW145.13 g/mol
LogP0.27
Rot. Bonds1

About 4-amino-3-fluorocyclopent-2-ene-1-carboxylic acid

4-amino-3-fluorocyclopent-2-ene-1-carboxylic acid (PubChem CID 73242045) has the molecular formula C6H8FNO2 and a molecular weight of 145.13 g/mol. Its IUPAC name is 4-amino-3-fluorocyclopent-2-ene-1-carboxylic acid.

Molecular Properties

Compound Name4-amino-3-fluorocyclopent-2-ene-1-carboxylic acid
PubChem CID73242045
Molecular FormulaC6H8FNO2
Molecular Weight145.13 g/mol
Exact Mass145.05
IUPAC Name4-amino-3-fluorocyclopent-2-ene-1-carboxylic acid
SMILESNC1CC(C(=O)O)C=C1F
InChIInChI=1S/C6H8FNO2/c7-4-1-3(6(9)10)2-5(4)8/h1,3,5H,2,8H2,(H,9,10)
InChIKeyHYFGNSPBWCIGEO-UHFFFAOYSA-N
XLogP0.27
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500145.13
LogP ≤ 50.27
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4-amino-3-fluorocyclopent-2-ene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-amino-3-fluorocyclopent-2-ene-1-carboxylic acid?
The IUPAC name of 4-amino-3-fluorocyclopent-2-ene-1-carboxylic acid (CID 73242045) is 4-amino-3-fluorocyclopent-2-ene-1-carboxylic acid.
What is the SMILES notation for 4-amino-3-fluorocyclopent-2-ene-1-carboxylic acid?
The canonical SMILES for 4-amino-3-fluorocyclopent-2-ene-1-carboxylic acid is NC1CC(C(=O)O)C=C1F.
What is the InChIKey of 4-amino-3-fluorocyclopent-2-ene-1-carboxylic acid?
The InChIKey is HYFGNSPBWCIGEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8FNO2/c7-4-1-3(6(9)10)2-5(4)8/h1,3,5H,2,8H2,(H,9,10).
What are the key properties of 4-amino-3-fluorocyclopent-2-ene-1-carboxylic acid?
4-amino-3-fluorocyclopent-2-ene-1-carboxylic acid has a molecular weight of 145.13 g/mol, XLogP of 0.27, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-fluorocyclopent-2-ene-1-carboxylic acid is sourced from PubChem (CID 73242045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).