C6H8FNO2 — CID 73242045
4-amino-3-fluorocyclopent-2-ene-1-carboxylic acid (PubChem CID 73242045) has the molecular formula C6H8FNO2 and a molecular weight of 145.13 g/mol. Its IUPAC name is 4-amino-3-fluorocyclopent-2-ene-1-carboxylic acid.
| Compound Name | 4-amino-3-fluorocyclopent-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 73242045 |
| Molecular Formula | C6H8FNO2 |
| Molecular Weight | 145.13 g/mol |
| Exact Mass | 145.05 |
| IUPAC Name | 4-amino-3-fluorocyclopent-2-ene-1-carboxylic acid |
| SMILES | NC1CC(C(=O)O)C=C1F |
| InChI | InChI=1S/C6H8FNO2/c7-4-1-3(6(9)10)2-5(4)8/h1,3,5H,2,8H2,(H,9,10) |
| InChIKey | HYFGNSPBWCIGEO-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.13 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |