C24H12O16S2 — CID 154241331
1,6-dihydroxy-7,12-disulfoperylene-3,4,9,10-tetracarboxylic acid (PubChem CID 154241331) has the molecular formula C24H12O16S2 and a molecular weight of 620.48 g/mol. Its IUPAC name is 1,6-dihydroxy-7,12-disulfoperylene-3,4,9,10-tetracarboxylic acid.
| Compound Name | 1,6-dihydroxy-7,12-disulfoperylene-3,4,9,10-tetracarboxylic acid |
|---|---|
| PubChem CID | 154241331 |
| Molecular Formula | C24H12O16S2 |
| Molecular Weight | 620.48 g/mol |
| Exact Mass | 619.96 |
| IUPAC Name | 1,6-dihydroxy-7,12-disulfoperylene-3,4,9,10-tetracarboxylic acid |
| SMILES | O=C(O)c1cc(O)c2c3c(S(=O)(=O)O)cc(C(=O)O)c4c(C(=O)O)cc(S(=O)(=O)O)c(c5c(O)cc(C(=O)O)c1c25)c43 |
| InChI | InChI=1S/C24H12O16S2/c25-9-1-5(21(27)28)13-6(22(29)30)2-10(26)16-18-12(42(38,39)40)4-8(24(33)34)14-7(23(31)32)3-11(41(35,36)37)17(20(14)18)15(9)19(13)16/h1-4,25-26H,(H,27,28)(H,29,30)(H,31,32)(H,33,34)(H,35,36,37)(H,38,39,40) |
| InChIKey | JFXOBIGHMQSQOD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 298.40 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.48 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|