C19H19N3O6 — CID 154246344
2-[[6-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-5-oxo-7,8-dihydronaphthalen-2-yl]oxy]ethyl acetate (PubChem CID 154246344) has the molecular formula C19H19N3O6 and a molecular weight of 385.38 g/mol. Its IUPAC name is 2-[[6-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-5-oxo-7,8-dihydronaphthalen-2-yl]oxy]ethyl acetate.
| Compound Name | 2-[[6-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-5-oxo-7,8-dihydronaphthalen-2-yl]oxy]ethyl acetate |
|---|---|
| PubChem CID | 154246344 |
| Molecular Formula | C19H19N3O6 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 2-[[6-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-5-oxo-7,8-dihydronaphthalen-2-yl]oxy]ethyl acetate |
| SMILES | CC(=O)OCCOc1ccc2c(c1)CCC(=Cc1ncc([N+](=O)[O-])n1C)C2=O |
| InChI | InChI=1S/C19H19N3O6/c1-12(23)27-7-8-28-15-5-6-16-13(9-15)3-4-14(19(16)24)10-17-20-11-18(21(17)2)22(25)26/h5-6,9-11H,3-4,7-8H2,1-2H3 |
| InChIKey | WCJNIDIXZYVFKO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 113.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|