C8H12O4 — CID 154262703
2-ethyl-1,3-dioxocane-4,8-dione (PubChem CID 154262703) has the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. Its IUPAC name is 2-ethyl-1,3-dioxocane-4,8-dione.
| Compound Name | 2-ethyl-1,3-dioxocane-4,8-dione |
|---|---|
| PubChem CID | 154262703 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 2-ethyl-1,3-dioxocane-4,8-dione |
| SMILES | CCC1OC(=O)CCCC(=O)O1 |
| InChI | InChI=1S/C8H12O4/c1-2-8-11-6(9)4-3-5-7(10)12-8/h8H,2-5H2,1H3 |
| InChIKey | KPAYLMGLOCQEFD-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |