C14H15N3OS — CID 154264062
2-sulfanylidene-3-(1,2,3,4-tetrahydronaphthalen-1-yl)-1H-imidazole-4-carboxamide (PubChem CID 154264062) has the molecular formula C14H15N3OS and a molecular weight of 273.36 g/mol. Its IUPAC name is 2-sulfanylidene-3-(1,2,3,4-tetrahydronaphthalen-1-yl)-1H-imidazole-4-carboxamide.
| Compound Name | 2-sulfanylidene-3-(1,2,3,4-tetrahydronaphthalen-1-yl)-1H-imidazole-4-carboxamide |
|---|---|
| PubChem CID | 154264062 |
| Molecular Formula | C14H15N3OS |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 2-sulfanylidene-3-(1,2,3,4-tetrahydronaphthalen-1-yl)-1H-imidazole-4-carboxamide |
| SMILES | NC(=O)c1c[nH]c(=S)n1C1CCCc2ccccc21 |
| InChI | InChI=1S/C14H15N3OS/c15-13(18)12-8-16-14(19)17(12)11-7-3-5-9-4-1-2-6-10(9)11/h1-2,4,6,8,11H,3,5,7H2,(H2,15,18)(H,16,19) |
| InChIKey | BSGRZEZYMOUFRG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 63.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|