C16H21Br2NO — CID 154272183
2,6-dibromo-4-[[cyclohexyl(cyclopropyl)amino]methyl]phenol (PubChem CID 154272183) has the molecular formula C16H21Br2NO and a molecular weight of 403.16 g/mol. Its IUPAC name is 2,6-dibromo-4-[[cyclohexyl(cyclopropyl)amino]methyl]phenol.
| Compound Name | 2,6-dibromo-4-[[cyclohexyl(cyclopropyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 154272183 |
| Molecular Formula | C16H21Br2NO |
| Molecular Weight | 403.16 g/mol |
| Exact Mass | 401.00 |
| IUPAC Name | 2,6-dibromo-4-[[cyclohexyl(cyclopropyl)amino]methyl]phenol |
| SMILES | Oc1c(Br)cc(CN(C2CCCCC2)C2CC2)cc1Br |
| InChI | InChI=1S/C16H21Br2NO/c17-14-8-11(9-15(18)16(14)20)10-19(13-6-7-13)12-4-2-1-3-5-12/h8-9,12-13,20H,1-7,10H2 |
| InChIKey | SPSSNYPXOLPOAC-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.16 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |