About methyl 2-nitroethanesulfinate
methyl 2-nitroethanesulfinate (PubChem CID 154274739) has the molecular formula C3H7NO4S
and a molecular weight of 153.16 g/mol. Its IUPAC name is methyl 2-nitroethanesulfinate.
Molecular Properties
| Compound Name | methyl 2-nitroethanesulfinate |
| PubChem CID | 154274739 |
| Molecular Formula | C3H7NO4S |
| Molecular Weight | 153.16 g/mol |
| Exact Mass | 153.01 |
| IUPAC Name | methyl 2-nitroethanesulfinate |
| SMILES | COS(=O)CC[N+](=O)[O-] |
| InChI | InChI=1S/C3H7NO4S/c1-8-9(7)3-2-4(5)6/h2-3H2,1H3 |
| InChIKey | OYPSOTBALOTWRN-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.16 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-nitroethanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-nitroethanesulfinate?
The IUPAC name of methyl 2-nitroethanesulfinate (CID 154274739) is methyl 2-nitroethanesulfinate.
What is the SMILES notation for methyl 2-nitroethanesulfinate?
The canonical SMILES for methyl 2-nitroethanesulfinate is COS(=O)CC[N+](=O)[O-].
What is the InChIKey of methyl 2-nitroethanesulfinate?
The InChIKey is OYPSOTBALOTWRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO4S/c1-8-9(7)3-2-4(5)6/h2-3H2,1H3.
What are the key properties of methyl 2-nitroethanesulfinate?
methyl 2-nitroethanesulfinate has a molecular weight of 153.16 g/mol, XLogP of -0.43, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-nitroethanesulfinate is sourced from PubChem (CID 154274739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).