C12H11ClS — CID 154275131
3-(2-chlorophenyl)-2,4-dimethylthiophene (PubChem CID 154275131) has the molecular formula C12H11ClS and a molecular weight of 222.74 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-2,4-dimethylthiophene.
| Compound Name | 3-(2-chlorophenyl)-2,4-dimethylthiophene |
|---|---|
| PubChem CID | 154275131 |
| Molecular Formula | C12H11ClS |
| Molecular Weight | 222.74 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | 3-(2-chlorophenyl)-2,4-dimethylthiophene |
| SMILES | Cc1csc(C)c1-c1ccccc1Cl |
| InChI | InChI=1S/C12H11ClS/c1-8-7-14-9(2)12(8)10-5-3-4-6-11(10)13/h3-7H,1-2H3 |
| InChIKey | NBBBIIKGYSSDJA-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.74 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |