C11H8Cl2S — CID 130088701
3-(2,3-dichlorophenyl)-4-methylthiophene (PubChem CID 130088701) has the molecular formula C11H8Cl2S and a molecular weight of 243.16 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)-4-methylthiophene.
| Compound Name | 3-(2,3-dichlorophenyl)-4-methylthiophene |
|---|---|
| PubChem CID | 130088701 |
| Molecular Formula | C11H8Cl2S |
| Molecular Weight | 243.16 g/mol |
| Exact Mass | 241.97 |
| IUPAC Name | 3-(2,3-dichlorophenyl)-4-methylthiophene |
| SMILES | Cc1cscc1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C11H8Cl2S/c1-7-5-14-6-9(7)8-3-2-4-10(12)11(8)13/h2-6H,1H3 |
| InChIKey | GGSNYTBUZUUQLR-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.16 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |