C11H9Cl2NS — CID 143281745
2-(2,3-dichlorophenyl)-4,5-dimethyl-1,3-thiazole (PubChem CID 143281745) has the molecular formula C11H9Cl2NS and a molecular weight of 258.17 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)-4,5-dimethyl-1,3-thiazole.
| Compound Name | 2-(2,3-dichlorophenyl)-4,5-dimethyl-1,3-thiazole |
|---|---|
| PubChem CID | 143281745 |
| Molecular Formula | C11H9Cl2NS |
| Molecular Weight | 258.17 g/mol |
| Exact Mass | 256.98 |
| IUPAC Name | 2-(2,3-dichlorophenyl)-4,5-dimethyl-1,3-thiazole |
| SMILES | Cc1nc(-c2cccc(Cl)c2Cl)sc1C |
| InChI | InChI=1S/C11H9Cl2NS/c1-6-7(2)15-11(14-6)8-4-3-5-9(12)10(8)13/h3-5H,1-2H3 |
| InChIKey | XJZHCHVEHVHCSI-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.17 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |