C27H30N2O4 — CID 154279545
3-[[(8R,9S,13S,14S)-3,17-dihydroxy-15-imino-2-methoxy-13-methyl-7,8,9,11,12,14,16,17-octahydro-6H-cyclopenta[a]phenanthren-6-yl]oxymethyl]benzonitrile (PubChem CID 154279545) has the molecular formula C27H30N2O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is 3-[[(8R,9S,13S,14S)-3,17-dihydroxy-15-imino-2-methoxy-13-methyl-7,8,9,11,12,14,16,17-octahydro-6H-cyclopenta[a]phenanthren-6-yl]oxymethyl]benzonitrile.
| Compound Name | 3-[[(8R,9S,13S,14S)-3,17-dihydroxy-15-imino-2-methoxy-13-methyl-7,8,9,11,12,14,16,17-octahydro-6H-cyclopenta[a]phenanthren-6-yl]oxymethyl]benzonitrile |
|---|---|
| PubChem CID | 154279545 |
| Molecular Formula | C27H30N2O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 3-[[(8R,9S,13S,14S)-3,17-dihydroxy-15-imino-2-methoxy-13-methyl-7,8,9,11,12,14,16,17-octahydro-6H-cyclopenta[a]phenanthren-6-yl]oxymethyl]benzonitrile |
| SMILES | [H]/N=C1\CC(O)[C@@]2(C)CC[C@@H]3c4cc(OC)c(O)cc4C(OCc4cccc(C#N)c4)C[C@H]3[C@H]12 |
| InChI | InChI=1S/C27H30N2O4/c1-27-7-6-17-18-10-24(32-2)22(30)9-19(18)23(11-20(17)26(27)21(29)12-25(27)31)33-14-16-5-3-4-15(8-16)13-28/h3-5,8-10,17,20,23,25-26,29-31H,6-7,11-12,14H2,1-2H3/b29-21+/t17-,20-,23?,25?,26-,27-/m1/s1 |
| InChIKey | DXAFKSTVZDDNGP-MSPQCBTNSA-N |
| XLogP | 4.83 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|