C27H33NO4 — CID 154356037
(8R,9S,13S,14S)-15-imino-2-methoxy-13-methyl-6-[(4-methylphenyl)methoxy]-7,8,9,11,12,14,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 154356037) has the molecular formula C27H33NO4 and a molecular weight of 435.56 g/mol. Its IUPAC name is (8R,9S,13S,14S)-15-imino-2-methoxy-13-methyl-6-[(4-methylphenyl)methoxy]-7,8,9,11,12,14,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8R,9S,13S,14S)-15-imino-2-methoxy-13-methyl-6-[(4-methylphenyl)methoxy]-7,8,9,11,12,14,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 154356037 |
| Molecular Formula | C27H33NO4 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | (8R,9S,13S,14S)-15-imino-2-methoxy-13-methyl-6-[(4-methylphenyl)methoxy]-7,8,9,11,12,14,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | [H]/N=C1\CC(O)[C@@]2(C)CC[C@@H]3c4cc(OC)c(O)cc4C(OCc4ccc(C)cc4)C[C@H]3[C@H]12 |
| InChI | InChI=1S/C27H33NO4/c1-15-4-6-16(7-5-15)14-32-23-12-20-17(18-11-24(31-3)22(29)10-19(18)23)8-9-27(2)25(30)13-21(28)26(20)27/h4-7,10-11,17,20,23,25-26,28-30H,8-9,12-14H2,1-3H3/b28-21+/t17-,20-,23?,25?,26-,27-/m1/s1 |
| InChIKey | JSRPROAVTXENHI-BRTRVZNZSA-N |
| XLogP | 5.27 |
| TPSA | 82.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|