C19H24O4S — CID 15428282
[(2R,3R)-2-hydroxy-3-methyl-5-phenylpentyl] 4-methylbenzenesulfonate (PubChem CID 15428282) has the molecular formula C19H24O4S and a molecular weight of 348.46 g/mol. Its IUPAC name is [(2R,3R)-2-hydroxy-3-methyl-5-phenylpentyl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3R)-2-hydroxy-3-methyl-5-phenylpentyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 15428282 |
| Molecular Formula | C19H24O4S |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | [(2R,3R)-2-hydroxy-3-methyl-5-phenylpentyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H](O)[C@H](C)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C19H24O4S/c1-15-8-12-18(13-9-15)24(21,22)23-14-19(20)16(2)10-11-17-6-4-3-5-7-17/h3-9,12-13,16,19-20H,10-11,14H2,1-2H3/t16-,19+/m1/s1 |
| InChIKey | UOAAMCCGMCKZTL-APWZRJJASA-N |
| XLogP | 3.33 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|