C22H24OP+ — CID 154291096
[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)-diphenylmethyl]-oxophosphanium (PubChem CID 154291096) has the molecular formula C22H24OP+ and a molecular weight of 335.41 g/mol. Its IUPAC name is [(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)-diphenylmethyl]-oxophosphanium.
| Compound Name | [(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)-diphenylmethyl]-oxophosphanium |
|---|---|
| PubChem CID | 154291096 |
| Molecular Formula | C22H24OP+ |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | [(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)-diphenylmethyl]-oxophosphanium |
| SMILES | CC1(C)C2CC=C(C([PH+]=O)(c3ccccc3)c3ccccc3)C1C2 |
| InChI | InChI=1S/C22H23OP/c1-21(2)18-13-14-19(20(21)15-18)22(24-23,16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12,14,18,20H,13,15H2,1-2H3/p+1 |
| InChIKey | XSAKZTYEJWUAOL-UHFFFAOYSA-O |
| XLogP | 5.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|