C8H15N3 — CID 154294298
3-propan-2-yl-2H-pyridine-2,3-diamine (PubChem CID 154294298) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is 3-propan-2-yl-2H-pyridine-2,3-diamine.
| Compound Name | 3-propan-2-yl-2H-pyridine-2,3-diamine |
|---|---|
| PubChem CID | 154294298 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 3-propan-2-yl-2H-pyridine-2,3-diamine |
| SMILES | CC(C)C1(N)C=CC=NC1N |
| InChI | InChI=1S/C8H15N3/c1-6(2)8(10)4-3-5-11-7(8)9/h3-7H,9-10H2,1-2H3 |
| InChIKey | AHTGMICVEMZIBN-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |