C7H13N3 — CID 154321895
3-ethyl-2H-pyridine-2,3-diamine (PubChem CID 154321895) has the molecular formula C7H13N3 and a molecular weight of 139.20 g/mol. Its IUPAC name is 3-ethyl-2H-pyridine-2,3-diamine.
| Compound Name | 3-ethyl-2H-pyridine-2,3-diamine |
|---|---|
| PubChem CID | 154321895 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | 3-ethyl-2H-pyridine-2,3-diamine |
| SMILES | CCC1(N)C=CC=NC1N |
| InChI | InChI=1S/C7H13N3/c1-2-7(9)4-3-5-10-6(7)8/h3-6H,2,8-9H2,1H3 |
| InChIKey | VNGNGWZNNPWUCN-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |