C18H31NO4Si — CID 15430016
(2S)-2-amino-3-[5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethoxy-3-methylphenyl]propanal (PubChem CID 15430016) has the molecular formula C18H31NO4Si and a molecular weight of 353.54 g/mol. Its IUPAC name is (2S)-2-amino-3-[5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethoxy-3-methylphenyl]propanal.
| Compound Name | (2S)-2-amino-3-[5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethoxy-3-methylphenyl]propanal |
|---|---|
| PubChem CID | 15430016 |
| Molecular Formula | C18H31NO4Si |
| Molecular Weight | 353.54 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | (2S)-2-amino-3-[5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethoxy-3-methylphenyl]propanal |
| SMILES | COc1c(C[C@H](N)C=O)cc(O[Si](C)(C)C(C)(C)C)c(OC)c1C |
| InChI | InChI=1S/C18H31NO4Si/c1-12-16(21-5)13(9-14(19)11-20)10-15(17(12)22-6)23-24(7,8)18(2,3)4/h10-11,14H,9,19H2,1-8H3/t14-/m0/s1 |
| InChIKey | KWWHTDPXLJWCTJ-AWEZNQCLSA-N |
| XLogP | 3.46 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.54 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|