About O-methyl 2-phenoxyethanethioate
O-methyl 2-phenoxyethanethioate (PubChem CID 154302065) has the molecular formula C9H10O2S
and a molecular weight of 182.24 g/mol. Its IUPAC name is O-methyl 2-phenoxyethanethioate.
Molecular Properties
| Compound Name | O-methyl 2-phenoxyethanethioate |
| PubChem CID | 154302065 |
| Molecular Formula | C9H10O2S |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | O-methyl 2-phenoxyethanethioate |
| SMILES | COC(=S)COc1ccccc1 |
| InChI | InChI=1S/C9H10O2S/c1-10-9(12)7-11-8-5-3-2-4-6-8/h2-6H,7H2,1H3 |
| InChIKey | LBUVCRMXUBCBGV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-methyl 2-phenoxyethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-methyl 2-phenoxyethanethioate?
The IUPAC name of O-methyl 2-phenoxyethanethioate (CID 154302065) is O-methyl 2-phenoxyethanethioate.
What is the SMILES notation for O-methyl 2-phenoxyethanethioate?
The canonical SMILES for O-methyl 2-phenoxyethanethioate is COC(=S)COc1ccccc1.
What is the InChIKey of O-methyl 2-phenoxyethanethioate?
The InChIKey is LBUVCRMXUBCBGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2S/c1-10-9(12)7-11-8-5-3-2-4-6-8/h2-6H,7H2,1H3.
What are the key properties of O-methyl 2-phenoxyethanethioate?
O-methyl 2-phenoxyethanethioate has a molecular weight of 182.24 g/mol, XLogP of 2.04, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-methyl 2-phenoxyethanethioate is sourced from PubChem (CID 154302065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).