C7H6Br2FN — CID 154310348
2,4-dibromo-5-(fluoromethyl)aniline (PubChem CID 154310348) has the molecular formula C7H6Br2FN and a molecular weight of 282.94 g/mol. Its IUPAC name is 2,4-dibromo-5-(fluoromethyl)aniline.
| Compound Name | 2,4-dibromo-5-(fluoromethyl)aniline |
|---|---|
| PubChem CID | 154310348 |
| Molecular Formula | C7H6Br2FN |
| Molecular Weight | 282.94 g/mol |
| Exact Mass | 280.89 |
| IUPAC Name | 2,4-dibromo-5-(fluoromethyl)aniline |
| SMILES | Nc1cc(CF)c(Br)cc1Br |
| InChI | InChI=1S/C7H6Br2FN/c8-5-2-6(9)7(11)1-4(5)3-10/h1-2H,3,11H2 |
| InChIKey | SBMGRAKSBTXPJF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.94 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|