C23H50O3Si2 — CID 15431301
(2S,3S)-2-methyl-3,4-bis[tri(propan-2-yl)silyloxy]butanal (PubChem CID 15431301) has the molecular formula C23H50O3Si2 and a molecular weight of 430.82 g/mol. Its IUPAC name is (2S,3S)-2-methyl-3,4-bis[tri(propan-2-yl)silyloxy]butanal.
| Compound Name | (2S,3S)-2-methyl-3,4-bis[tri(propan-2-yl)silyloxy]butanal |
|---|---|
| PubChem CID | 15431301 |
| Molecular Formula | C23H50O3Si2 |
| Molecular Weight | 430.82 g/mol |
| Exact Mass | 430.33 |
| IUPAC Name | (2S,3S)-2-methyl-3,4-bis[tri(propan-2-yl)silyloxy]butanal |
| SMILES | CC(C=O)[C@@H](CO[Si](C(C)C)(C(C)C)C(C)C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H50O3Si2/c1-16(2)27(17(3)4,18(5)6)25-15-23(22(13)14-24)26-28(19(7)8,20(9)10)21(11)12/h14,16-23H,15H2,1-13H3/t22?,23-/m1/s1 |
| InChIKey | KFYOARXVYZVPIS-OZAIVSQSSA-N |
| XLogP | 7.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.82 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|