C16H28O5S — CID 15431444
methyl (1R,2R,4S,5S,6S,8S)-2,6-dimethyl-5-methylsulfonyloxy-8-propan-2-ylbicyclo[2.2.2]octane-2-carboxylate (PubChem CID 15431444) has the molecular formula C16H28O5S and a molecular weight of 332.46 g/mol. Its IUPAC name is methyl (1R,2R,4S,5S,6S,8S)-2,6-dimethyl-5-methylsulfonyloxy-8-propan-2-ylbicyclo[2.2.2]octane-2-carboxylate.
| Compound Name | methyl (1R,2R,4S,5S,6S,8S)-2,6-dimethyl-5-methylsulfonyloxy-8-propan-2-ylbicyclo[2.2.2]octane-2-carboxylate |
|---|---|
| PubChem CID | 15431444 |
| Molecular Formula | C16H28O5S |
| Molecular Weight | 332.46 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | methyl (1R,2R,4S,5S,6S,8S)-2,6-dimethyl-5-methylsulfonyloxy-8-propan-2-ylbicyclo[2.2.2]octane-2-carboxylate |
| SMILES | COC(=O)[C@]1(C)C[C@@H]2[C@@H](OS(C)(=O)=O)[C@@H](C)[C@H]1C[C@H]2C(C)C |
| InChI | InChI=1S/C16H28O5S/c1-9(2)11-7-13-10(3)14(21-22(6,18)19)12(11)8-16(13,4)15(17)20-5/h9-14H,7-8H2,1-6H3/t10-,11-,12-,13+,14-,16+/m0/s1 |
| InChIKey | DTTVYMAXIZEIFC-SFYOKDCNSA-N |
| XLogP | 2.46 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.46 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|