C16H24O3 — CID 177418994
methyl (1R,3R,5S,6S,7S)-1-methyl-2-oxo-5-propan-2-yltricyclo[4.3.1.03,7]decane-3-carboxylate (PubChem CID 177418994) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is methyl (1R,3R,5S,6S,7S)-1-methyl-2-oxo-5-propan-2-yltricyclo[4.3.1.03,7]decane-3-carboxylate.
| Compound Name | methyl (1R,3R,5S,6S,7S)-1-methyl-2-oxo-5-propan-2-yltricyclo[4.3.1.03,7]decane-3-carboxylate |
|---|---|
| PubChem CID | 177418994 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | methyl (1R,3R,5S,6S,7S)-1-methyl-2-oxo-5-propan-2-yltricyclo[4.3.1.03,7]decane-3-carboxylate |
| SMILES | COC(=O)[C@]12C[C@@H](C(C)C)[C@@H]3C[C@@](C)(CC[C@@H]31)C2=O |
| InChI | InChI=1S/C16H24O3/c1-9(2)10-8-16(14(18)19-4)12-5-6-15(3,13(16)17)7-11(10)12/h9-12H,5-8H2,1-4H3/t10-,11-,12-,15+,16+/m0/s1 |
| InChIKey | LKZPZKQHPQKCDN-GWIBLVFBSA-N |
| XLogP | 2.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|