About (2-cyanophenyl) hypoiodite
(2-cyanophenyl) hypoiodite (PubChem CID 154315791) has the molecular formula C7H4INO
and a molecular weight of 245.02 g/mol. Its IUPAC name is (2-cyanophenyl) hypoiodite.
Molecular Properties
| Compound Name | (2-cyanophenyl) hypoiodite |
| PubChem CID | 154315791 |
| Molecular Formula | C7H4INO |
| Molecular Weight | 245.02 g/mol |
| Exact Mass | 244.93 |
| IUPAC Name | (2-cyanophenyl) hypoiodite |
| SMILES | N#Cc1ccccc1OI |
| InChI | InChI=1S/C7H4INO/c8-10-7-4-2-1-3-6(7)5-9/h1-4H |
| InChIKey | AXUUVBIJDWNVSU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.02 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2-cyanophenyl) hypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyanophenyl) hypoiodite?
The IUPAC name of (2-cyanophenyl) hypoiodite (CID 154315791) is (2-cyanophenyl) hypoiodite.
What is the SMILES notation for (2-cyanophenyl) hypoiodite?
The canonical SMILES for (2-cyanophenyl) hypoiodite is N#Cc1ccccc1OI.
What is the InChIKey of (2-cyanophenyl) hypoiodite?
The InChIKey is AXUUVBIJDWNVSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4INO/c8-10-7-4-2-1-3-6(7)5-9/h1-4H.
What are the key properties of (2-cyanophenyl) hypoiodite?
(2-cyanophenyl) hypoiodite has a molecular weight of 245.02 g/mol, XLogP of 2.29, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyanophenyl) hypoiodite is sourced from PubChem (CID 154315791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).