C18H14ClFN2O3 — CID 154316252
2-[(4-chlorophenyl)methyl]-8-fluoro-6-(hydroxymethyl)-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 154316252) has the molecular formula C18H14ClFN2O3 and a molecular weight of 360.77 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl]-8-fluoro-6-(hydroxymethyl)-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | 2-[(4-chlorophenyl)methyl]-8-fluoro-6-(hydroxymethyl)-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 154316252 |
| Molecular Formula | C18H14ClFN2O3 |
| Molecular Weight | 360.77 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl]-8-fluoro-6-(hydroxymethyl)-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | NC(=O)c1c(Cc2ccc(Cl)cc2)[nH]c2c(F)cc(CO)cc2c1=O |
| InChI | InChI=1S/C18H14ClFN2O3/c19-11-3-1-9(2-4-11)7-14-15(18(21)25)17(24)12-5-10(8-23)6-13(20)16(12)22-14/h1-6,23H,7-8H2,(H2,21,25)(H,22,24) |
| InChIKey | AEPNEJQZVVCKFT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.77 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |