C16H12O2 — CID 59018474
5-(hydroxymethyl)tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaen-2-one (PubChem CID 59018474) has the molecular formula C16H12O2 and a molecular weight of 236.27 g/mol. Its IUPAC name is 5-(hydroxymethyl)tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaen-2-one.
| Compound Name | 5-(hydroxymethyl)tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaen-2-one |
|---|---|
| PubChem CID | 59018474 |
| Molecular Formula | C16H12O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 5-(hydroxymethyl)tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaen-2-one |
| SMILES | O=c1c2ccccc2ccc2ccc(CO)cc12 |
| InChI | InChI=1S/C16H12O2/c17-10-11-5-6-13-8-7-12-3-1-2-4-14(12)16(18)15(13)9-11/h1-9,17H,10H2 |
| InChIKey | PSOOSBKZCAVLRE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |