C18H23N5O2 — CID 154324516
2-(6-carbamimidoylnaphthalen-2-yl)-2-(diaminomethylideneamino)hexanoic acid (PubChem CID 154324516) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is 2-(6-carbamimidoylnaphthalen-2-yl)-2-(diaminomethylideneamino)hexanoic acid.
| Compound Name | 2-(6-carbamimidoylnaphthalen-2-yl)-2-(diaminomethylideneamino)hexanoic acid |
|---|---|
| PubChem CID | 154324516 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 2-(6-carbamimidoylnaphthalen-2-yl)-2-(diaminomethylideneamino)hexanoic acid |
| SMILES | [H]/N=C(\N)c1ccc2cc(C(CCCC)(N=C(N)N)C(=O)O)ccc2c1 |
| InChI | InChI=1S/C18H23N5O2/c1-2-3-8-18(16(24)25,23-17(21)22)14-7-6-11-9-13(15(19)20)5-4-12(11)10-14/h4-7,9-10H,2-3,8H2,1H3,(H3,19,20)(H,24,25)(H4,21,22,23) |
| InChIKey | LRXKQLLDWMLUJB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 151.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|