C35H32N2O3S — CID 154326219
benzyl (5R)-7-oxo-6-(tritylamino)spiro[4-thia-1-azabicyclo[3.2.0]heptane-3,1'-cyclobutane]-2-carboxylate (PubChem CID 154326219) has the molecular formula C35H32N2O3S and a molecular weight of 560.72 g/mol. Its IUPAC name is benzyl (5R)-7-oxo-6-(tritylamino)spiro[4-thia-1-azabicyclo[3.2.0]heptane-3,1'-cyclobutane]-2-carboxylate.
| Compound Name | benzyl (5R)-7-oxo-6-(tritylamino)spiro[4-thia-1-azabicyclo[3.2.0]heptane-3,1'-cyclobutane]-2-carboxylate |
|---|---|
| PubChem CID | 154326219 |
| Molecular Formula | C35H32N2O3S |
| Molecular Weight | 560.72 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | benzyl (5R)-7-oxo-6-(tritylamino)spiro[4-thia-1-azabicyclo[3.2.0]heptane-3,1'-cyclobutane]-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)C1N2C(=O)C(NC(c3ccccc3)(c3ccccc3)c3ccccc3)[C@H]2SC12CCC2 |
| InChI | InChI=1S/C35H32N2O3S/c38-31-29(32-37(31)30(34(41-32)22-13-23-34)33(39)40-24-25-14-5-1-6-15-25)36-35(26-16-7-2-8-17-26,27-18-9-3-10-19-27)28-20-11-4-12-21-28/h1-12,14-21,29-30,32,36H,13,22-24H2/t29?,30?,32-/m1/s1 |
| InChIKey | MWUGDPUIQVIQKQ-PUISUKFNSA-N |
| XLogP | 5.89 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.72 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|