C29H28N2O4S — CID 22806708
(5S)-7-oxo-6-(tritylamino)spiro[4-thia-1-azabicyclo[3.2.0]heptane-3,4'-oxane]-2-carboxylic acid (PubChem CID 22806708) has the molecular formula C29H28N2O4S and a molecular weight of 500.62 g/mol. Its IUPAC name is (5S)-7-oxo-6-(tritylamino)spiro[4-thia-1-azabicyclo[3.2.0]heptane-3,4'-oxane]-2-carboxylic acid.
| Compound Name | (5S)-7-oxo-6-(tritylamino)spiro[4-thia-1-azabicyclo[3.2.0]heptane-3,4'-oxane]-2-carboxylic acid |
|---|---|
| PubChem CID | 22806708 |
| Molecular Formula | C29H28N2O4S |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | (5S)-7-oxo-6-(tritylamino)spiro[4-thia-1-azabicyclo[3.2.0]heptane-3,4'-oxane]-2-carboxylic acid |
| SMILES | O=C(O)C1N2C(=O)C(NC(c3ccccc3)(c3ccccc3)c3ccccc3)[C@@H]2SC12CCOCC2 |
| InChI | InChI=1S/C29H28N2O4S/c32-25-23(26-31(25)24(27(33)34)28(36-26)16-18-35-19-17-28)30-29(20-10-4-1-5-11-20,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-15,23-24,26,30H,16-19H2,(H,33,34)/t23?,24?,26-/m0/s1 |
| InChIKey | NYDVCQBETSMIHE-RSMFLLDRSA-N |
| XLogP | 3.85 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|