C27H25N3O2S — CID 154086742
(5R)-2-isocyanato-3,3-dimethyl-6-(tritylamino)-4-thia-1-azabicyclo[3.2.0]heptan-7-one (PubChem CID 154086742) has the molecular formula C27H25N3O2S and a molecular weight of 455.58 g/mol. Its IUPAC name is (5R)-2-isocyanato-3,3-dimethyl-6-(tritylamino)-4-thia-1-azabicyclo[3.2.0]heptan-7-one.
| Compound Name | (5R)-2-isocyanato-3,3-dimethyl-6-(tritylamino)-4-thia-1-azabicyclo[3.2.0]heptan-7-one |
|---|---|
| PubChem CID | 154086742 |
| Molecular Formula | C27H25N3O2S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | (5R)-2-isocyanato-3,3-dimethyl-6-(tritylamino)-4-thia-1-azabicyclo[3.2.0]heptan-7-one |
| SMILES | CC1(C)S[C@@H]2C(NC(c3ccccc3)(c3ccccc3)c3ccccc3)C(=O)N2C1N=C=O |
| InChI | InChI=1S/C27H25N3O2S/c1-26(2)25(28-18-31)30-23(32)22(24(30)33-26)29-27(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21/h3-17,22,24-25,29H,1-2H3/t22?,24-,25?/m1/s1 |
| InChIKey | SIEJZAUOMNTCBJ-KWKWTDQQSA-N |
| XLogP | 4.29 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|