C35H34N6O2S — CID 70605206
(5R)-2-[1-[(2-methoxyphenyl)methyl]tetrazol-5-yl]-3,3-dimethyl-6-(tritylamino)-4-thia-1-azabicyclo[3.2.0]heptan-7-one (PubChem CID 70605206) has the molecular formula C35H34N6O2S and a molecular weight of 602.76 g/mol. Its IUPAC name is (5R)-2-[1-[(2-methoxyphenyl)methyl]tetrazol-5-yl]-3,3-dimethyl-6-(tritylamino)-4-thia-1-azabicyclo[3.2.0]heptan-7-one.
| Compound Name | (5R)-2-[1-[(2-methoxyphenyl)methyl]tetrazol-5-yl]-3,3-dimethyl-6-(tritylamino)-4-thia-1-azabicyclo[3.2.0]heptan-7-one |
|---|---|
| PubChem CID | 70605206 |
| Molecular Formula | C35H34N6O2S |
| Molecular Weight | 602.76 g/mol |
| Exact Mass | 602.25 |
| IUPAC Name | (5R)-2-[1-[(2-methoxyphenyl)methyl]tetrazol-5-yl]-3,3-dimethyl-6-(tritylamino)-4-thia-1-azabicyclo[3.2.0]heptan-7-one |
| SMILES | COc1ccccc1Cn1nnnc1C1N2C(=O)C(NC(c3ccccc3)(c3ccccc3)c3ccccc3)[C@H]2SC1(C)C |
| InChI | InChI=1S/C35H34N6O2S/c1-34(2)30(31-37-38-39-40(31)23-24-15-13-14-22-28(24)43-3)41-32(42)29(33(41)44-34)36-35(25-16-7-4-8-17-25,26-18-9-5-10-19-26)27-20-11-6-12-21-27/h4-22,29-30,33,36H,23H2,1-3H3/t29?,30?,33-/m1/s1 |
| InChIKey | GPIABHRTNDTMBP-IAHUFCAJSA-N |
| XLogP | 5.42 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.76 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|