C45H44N4O7S2 — CID 22797877
2-[(5S)-3,3-dimethyl-7-oxo-6-(tritylamino)-4-thia-1-azabicyclo[3.2.0]heptan-2-yl]-1-[(4-methoxyphenyl)methyl]pyrimidine-4,6-dione;4-methylbenzenesulfonic acid (PubChem CID 22797877) has the molecular formula C45H44N4O7S2 and a molecular weight of 817.00 g/mol. Its IUPAC name is 2-[(5S)-3,3-dimethyl-7-oxo-6-(tritylamino)-4-thia-1-azabicyclo[3.2.0]heptan-2-yl]-1-[(4-methoxyphenyl)methyl]pyrimidine-4,6-dione;4-methylbenzenesulfonic acid.
| Compound Name | 2-[(5S)-3,3-dimethyl-7-oxo-6-(tritylamino)-4-thia-1-azabicyclo[3.2.0]heptan-2-yl]-1-[(4-methoxyphenyl)methyl]pyrimidine-4,6-dione;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 22797877 |
| Molecular Formula | C45H44N4O7S2 |
| Molecular Weight | 817.00 g/mol |
| Exact Mass | 816.27 |
| IUPAC Name | 2-[(5S)-3,3-dimethyl-7-oxo-6-(tritylamino)-4-thia-1-azabicyclo[3.2.0]heptan-2-yl]-1-[(4-methoxyphenyl)methyl]pyrimidine-4,6-dione;4-methylbenzenesulfonic acid |
| SMILES | COc1ccc(CN2C(=O)CC(=O)N=C2C2N3C(=O)C(NC(c4ccccc4)(c4ccccc4)c4ccccc4)[C@@H]3SC2(C)C)cc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C38H36N4O4S.C7H8O3S/c1-37(2)33(34-39-30(43)23-31(44)41(34)24-25-19-21-29(46-3)22-20-25)42-35(45)32(36(42)47-37)40-38(26-13-7-4-8-14-26,27-15-9-5-10-16-27)28-17-11-6-12-18-28;1-6-2-4-7(5-3-6)11(8,9)10/h4-22,32-33,36,40H,23-24H2,1-3H3;2-5H,1H3,(H,8,9,10)/t32?,33?,36-;/m0./s1 |
| InChIKey | NLOKVZNJAFAKBC-WTXUMZPZSA-N |
| XLogP | 6.61 |
| TPSA | 145.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.00 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|